Benzyl benzoate
| Chemical identification | |
|---|---|
| Pubchem identifier | 2345 |
| CAS identifier | 120-51-4 |
| DSSTOX identifier | DTXSID8029153 |
| IUPAC name | Benzyl benzoate |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | SESFRYSPDFLNCH-UHFFFAOYSA-N |
| Synonyms | Paragard t380a; Copper, elemental; Copper M 1; Cuprum metallicum; Pigment metal 2; Tatum-T; Copper metal powder; Copper-airborne; M1 (Copper); Copper; CU M3; CDA 101; Cu-7; C 100 (metal); Copper slag-airborne; Bronze powder; Copper slag-milled; Electrolytic refinery billet copper; CDA 122; CE 7 (metal); Copper precipitates; CDA 110; Copper fulleride (CuC20); Blister copper; E 115 (metal); Kafar copper; Anode copper; M3 (Copper); Rame; Gold bronze; M4 (Copper); Copper-milled; CDX (metal); CE 1110; Copper, dusts and mists; Paragard T 380a; OFHC Cu; M3S; Cutox 6030; Copper, metallic powder; Copper powder; Cuprum; CDA 102; Cutox 6010; Cathode copper; Copper bronze; M3R; Raney copper; Copper, fume; 1721 Gold; Electrolytic refinery wirebar copper; M2 (Copper); AC 110; Copper dust |
| Odor profile | |
|---|---|
| Odor classes | Aromatic, Citrus, Edible oil, Fermented, Floral, Herbs, Peppers, Sweet spices, Vegetable |
| Reference | [1] |
| Presence in Children's products | |
|---|---|
| Broad category | Diapering, Hair care, Miscellaneous, Skin care, Toys |
| Subcategory | Baby Wipes, Baby Shampoo And Shower Gel, General Baby products, Baby Gel, Baby Moisturizing Cream and Lotion, Paper Toys, Plastic Toys, Clay Toys, Plush Toys, Scented Toys |
| Chemical classification based on ClassyFire | |
|---|---|
| Chemical kingdom | Organic compounds |
| Chemical super-class | Benzenoids |
| Chemical class | Benzene and substituted derivatives |
| Chemical subclass | Benzoic acids and derivatives |
| Natural source for the chemical | |||
|---|---|---|---|
| Organism | Kingdom | Genus | Family |
| Cananga odorata | Plantae | Cananga | Annonaceae |
| Dianthus caryophyllus | Plantae | Dianthus | Caryophyllaceae |
| Phagnalon sordidum | Plantae | Phagnalon | Asteraceae |
| Citrus reticulata | Plantae | Citrus | Rutaceae |
| Jasminum grandiflorum | Plantae | Jasminum | Oleaceae |
| Reference | [1], [2], [3], [4], [5] | ||