Summary
SMILES: CCCCCCCCCCCC(=O)OInChI: InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)InChIKey: POULHZVOKOAJMA-UHFFFAOYSA-N
DeepSMILES: CCCCCCCCCCCC=O)O
Functional groups: CC(=O)O
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Lipids and lipid-like moleculesClassyFire Class: Fatty Acyls
ClassyFire Subclass: Fatty acids and conjugates
NP Classifier Biosynthetic pathway: Fatty acids
NP Classifier Superclass: Fatty Acids and Conjugates
NP Classifier Class: Branched fatty acids|Unsaturated fatty acids
Synonymous chemical names:dodecanoic acid, dodecanoic acid, dodecanoic acid (lauric acid), dodecanoicacid, lauric, lauric (dodecanoic) acid, lauric acid, lauric acid (c12), lauric acid (dodecanoic acid), lauric-acid, n-dodecanoic acid
External chemical identifiers:CID:3893; ChEMBL:CHEMBL108766; ChEBI:30805; ZINC:ZINC000001529498; FDASRS:1160N9NU9U; SureChEMBL:SCHEMBL5895; MolPort-000-881-524
Chemical structure download