Summary
SMILES: CCCCCCCCC(=O)OInChI: InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)InChIKey: FBUKVWPVBMHYJY-UHFFFAOYSA-N
DeepSMILES: CCCCCCCCC=O)O
Functional groups: CC(=O)O
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Lipids and lipid-like moleculesClassyFire Class: Fatty Acyls
ClassyFire Subclass: Fatty acids and conjugates
NP Classifier Biosynthetic pathway: Fatty acids
NP Classifier Superclass: Fatty Acids and Conjugates
NP Classifier Class: Branched fatty acids|Unsaturated fatty acids
Synonymous chemical names:n-nonanoic acid, nonanoic acid, nonanoic acid, nonylic acid, pelargonic acid, pelargonic acid (c9), pelargonic acid (nonanoic acid), pelargonic acid�
External chemical identifiers:CID:8158; ChEMBL:CHEMBL108436; ChEBI:29019; ZINC:ZINC000001529234; FDASRS:97SEH7577T; SureChEMBL:SCHEMBL21966; MolPort-000-881-522
Chemical structure download