Summary
IMPPAT Phytochemical identifier: IMPHY000461
Phytochemical name: Phthalic acid bis ester
Synonymous chemical names:phthalic acid bis ester
Chemical structure information
SMILES:CC(COC(=O)c1ccccc1C(=O)OCC(CCC(C)C)C)CCC(C)CInChI:InChI=1S/C24H38O4/c1-17(2)11-13-19(5)15-27-23(25)21-9-7-8-10-22(21)24(26)28-16-20(6)14-12-18(3)4/h7-10,17-20H,11-16H2,1-6H3InChIKey:ZYGMNEYWBPNMPT-UHFFFAOYSA-N
DeepSMILES:CCCOC=O)cccccc6C=O)OCCCCCC)C))))C))))))))))))))CCCC)C
Functional groups:cC(=O)OC
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccccc1
Scaffold Graph/Node level:C1CCCCC1
Scaffold Graph level:C1CCCCC1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: BenzenoidsClassyFire Class: Benzene and substituted derivatives
ClassyFire Subclass: Benzoic acids and derivatives
NP Classifier Biosynthetic pathway: Terpenoids
NP-Likeness score: 0.191
Chemical structure download