Summary
IMPPAT Phytochemical identifier: IMPHY000513
Phytochemical name: Purpurin B
Synonymous chemical names:purpurin b
Chemical structure information
SMILES:N#C/C(=Cc1ccc(c(c1)CC=C(C)C)O)/C(=C/c1ccc(cc1)O)/C#NInChI:InChI=1S/C23H20N2O2/c1-16(2)3-7-19-12-18(6-10-23(19)27)13-21(15-25)20(14-24)11-17-4-8-22(26)9-5-17/h3-6,8-13,26-27H,7H2,1-2H3/b20-11+,21-13+InChIKey:MEHGRNDEWRTQNA-VZLKJUJQSA-N
DeepSMILES:N#C/C=Ccccccc6)CC=CC)C)))))O))))))/C=C/cccccc6))O))))))/C#N
Functional groups:CC=C(C)C, c/C=C(C#N)/C(C#N)=C/c, cO
Molecular scaffolds
Scaffold Graph/Node/Bond level:C(C=Cc1ccccc1)=Cc1ccccc1
Scaffold Graph/Node level:C1CCC(CCCCC2CCCCC2)CC1
Scaffold Graph level:C1CCC(CCCCC2CCCCC2)CC1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Lignans, neolignans and related compoundsNP Classifier Biosynthetic pathway: Amino acids and Peptides, Shikimates and Phenylpropanoids
NP Classifier Superclass: Small peptides
NP Classifier Class: Aminoacids
NP-Likeness score: 0.785
Chemical structure download