Summary
IMPPAT Phytochemical identifier: IMPHY000525
Phytochemical name: Dillapionic acid
Synonymous chemical names:dillapionic acid
Chemical structure information
SMILES:COc1c(cc2c(c1OC)OCO2)C(=O)OInChI:InChI=1S/C10H10O6/c1-13-7-5(10(11)12)3-6-8(9(7)14-2)16-4-15-6/h3H,4H2,1-2H3,(H,11,12)InChIKey:FRDRMVXVIUVAPV-UHFFFAOYSA-N
DeepSMILES:COcccccc6OC)))OCO5))))))C=O)O
Functional groups:c1cOCO1, cC(=O)O, cOC
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccc2c(c1)OCO2
Scaffold Graph/Node level:C1CCC2OCOC2C1
Scaffold Graph level:C1CCC2CCCC2C1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: BenzenoidsClassyFire Class: Benzene and substituted derivatives
ClassyFire Subclass: Benzoic acids and derivatives
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP Classifier Superclass: Phenolic acids (C6-C1)
NP Classifier Class: Simple phenolic acids
NP-Likeness score: 0.703
Chemical structure download