Summary
IMPPAT Phytochemical identifier: IMPHY008992
Phytochemical name: P-nitrobenzoate
Synonymous chemical names:p-nitrobenzoate
Chemical structure information
SMILES:[O-]C(=O)c1ccc(cc1)[N+](=O)[O-]InChI:InChI=1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10)/p-1InChIKey:OTLNPYWUJOZPPA-UHFFFAOYSA-M
DeepSMILES:[O-]C=O)cccccc6))[N+]=O)[O-]
Functional groups:cC(=O)[O-], c[N+](=O)[O-]
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccccc1
Scaffold Graph/Node level:C1CCCCC1
Scaffold Graph level:C1CCCCC1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: BenzenoidsClassyFire Class: Benzene and substituted derivatives
ClassyFire Subclass: Benzoic acids and derivatives
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP-Likeness score: -1.146
Chemical structure download