Summary
IMPPAT Phytochemical identifier: IMPHY010735
Phytochemical name: Murrangatin isovalerate
Synonymous chemical names:murrangatin isovalerate
Chemical structure information
SMILES:COc1ccc2c(c1C(C(=O)C(C)C)OC(=O)CC(C)C)oc(=O)cc2InChI:InChI=1S/C20H24O6/c1-11(2)10-16(22)26-20(18(23)12(3)4)17-14(24-5)8-6-13-7-9-15(21)25-19(13)17/h6-9,11-12,20H,10H2,1-5H3InChIKey:OBHRYPZHQYYDFI-UHFFFAOYSA-N
DeepSMILES:COcccccc6CC=O)CC)C)))OC=O)CCC)C)))))))oc=O)cc6
Functional groups:CC(C)=O, COC(C)=O, c=O, cOC, coc
Molecular scaffolds
Scaffold Graph/Node/Bond level:O=c1ccc2ccccc2o1
Scaffold Graph/Node level:OC1CCC2CCCCC2O1
Scaffold Graph level:CC1CCC2CCCCC2C1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Phenylpropanoids and polyketidesClassyFire Class: Coumarins and derivatives
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP Classifier Superclass: Coumarins
NP Classifier Class: Simple coumarins
NP-Likeness score: 0.953
Chemical structure download