Summary
IMPPAT Phytochemical identifier: IMPHY010744
Phytochemical name: Murraxonin
Synonymous chemical names:murraxonin
Chemical structure information
SMILES:COc1c(O)oc2c1cc(/C=C/C(=O)C)cc2InChI:InChI=1S/C13H12O4/c1-8(14)3-4-9-5-6-11-10(7-9)12(16-2)13(15)17-11/h3-7,15H,1-2H3/b4-3+InChIKey:NGLQPPQDBIMYKL-ONEGZZNKSA-N
DeepSMILES:COccO)occ5cc/C=C/C=O)C))))cc6
Functional groups:c/C=C/C(C)=O, cO, cOC, coc
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccc2occc2c1
Scaffold Graph/Node level:C1CCC2OCCC2C1
Scaffold Graph level:C1CCC2CCCC2C1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Phenylpropanoids and polyketidesClassyFire Class: Cinnamic acids and derivatives
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP-Likeness score: 1.107
Chemical structure download