Summary
IMPPAT Phytochemical identifier: IMPHY010758
Phytochemical name: Murranganon
Synonymous chemical names:murpaniculol, murranganon
Chemical structure information
SMILES:COc1ccc2c(c1C(C(=O)C(C)C)O)oc(=O)cc2InChI:InChI=1S/C15H16O5/c1-8(2)13(17)14(18)12-10(19-3)6-4-9-5-7-11(16)20-15(9)12/h4-8,14,18H,1-3H3InChIKey:QPXQLCIYAJVXPH-UHFFFAOYSA-N
DeepSMILES:COcccccc6CC=O)CC)C)))O)))oc=O)cc6
Functional groups:CC(C)=O, CO, c=O, cOC, coc
Molecular scaffolds
Scaffold Graph/Node/Bond level:O=c1ccc2ccccc2o1
Scaffold Graph/Node level:OC1CCC2CCCCC2O1
Scaffold Graph level:CC1CCC2CCCCC2C1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Phenylpropanoids and polyketidesClassyFire Class: Coumarins and derivatives
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP Classifier Superclass: Coumarins
NP Classifier Class: Simple coumarins
NP-Likeness score: 1.138
Chemical structure download