Summary
IMPPAT Phytochemical identifier: IMPHY011280
Phytochemical name: 9-Hydroperoxy-10,12-octadecadienoic acid
Synonymous chemical names:9-hydroperoxy-10,12-octadecadienoic acid
Chemical structure information
SMILES:CCCCCC=CC=CC(CCCCCCCC(=O)O)OOInChI:InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17,21H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20)InChIKey:JGUNZIWGNMQSBM-UHFFFAOYSA-N
DeepSMILES:CCCCCC=CC=CCCCCCCCCC=O)O)))))))))OO
Functional groups:CC(=O)O, CC=CC=CC, COO
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Lipids and lipid-like moleculesClassyFire Class: Fatty acyls
ClassyFire Subclass: Lineolic acids and derivatives
NP Classifier Biosynthetic pathway: Fatty acids
NP Classifier Superclass: Octadecanoids
NP Classifier Class: Other Octadecanoids
NP-Likeness score: 1.988
Chemical structure download