Summary
IMPPAT Phytochemical identifier:  IMPHY012557
Phytochemical name:  Irehine
Synonymous chemical names:irehine
External chemical identifiers:CID:442978, ChEBI:5960, ZINC:ZINC000004098875
Chemical structure information
SMILES:
O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC[C@@H]2[C@@H](N(C)C)C)C)C1)CInChI:
InChI=1S/C23H39NO/c1-15(24(4)5)19-8-9-20-18-7-6-16-14-17(25)10-12-22(16,2)21(18)11-13-23(19,20)3/h6,15,17-21,25H,7-14H2,1-5H3/t15-,17-,18-,19+,20-,21-,22-,23+/m0/s1InChIKey:
UJGXCOFZMJCRLN-VBFLNORGSA-NDeepSMILES:
O[C@H]CC[C@]C=CC[C@@H][C@@H]6CC[C@][C@H]6CC[C@@H]5[C@@H]NC)C))C))))))C))))))))C6))CFunctional groups:
CC=C(C)C, CN(C)C, CO
Molecular scaffolds
Scaffold Graph/Node/Bond level:
C1=C2CCCCC2C2CCC3CCCC3C2C1Scaffold Graph/Node level:
C1CCC2C(C1)CCC1C3CCCC3CCC21Scaffold Graph level:
C1CCC2C(C1)CCC1C3CCCC3CCC21
Chemical classification
ClassyFire Kingdom:  Organic compoundsClassyFire Superclass: Lipids and lipid-like moleculesClassyFire Class:  Steroids and steroid derivatives
ClassyFire Subclass:  Pregnane steroids
NP Classifier Biosynthetic pathway:  Terpenoids
NP Classifier Superclass:  Steroids
NP Classifier Class:  Pregnane steroids
NP-Likeness score:  2.71
Chemical structure download