Summary
IMPPAT Phytochemical identifier: IMPHY017922
Phytochemical name: 4-Hexenyl acetate
Synonymous chemical names:4-hexenyl acetate
Chemical structure information
SMILES:CC=CCCCOC(=O)CInChI:InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h3-4H,5-7H2,1-2H3InChIKey:SXIMDPDAXHQFFD-UHFFFAOYSA-N
DeepSMILES:CC=CCCCOC=O)C
Functional groups:CC=CC, COC(C)=O
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Organic acids and derivativesClassyFire Class: Carboxylic acids and derivatives
ClassyFire Subclass: Carboxylic acid derivatives
NP Classifier Biosynthetic pathway: Fatty acids
NP Classifier Superclass: Fatty esters
NP Classifier Class: Wax monoesters
NP-Likeness score: 1.799
Chemical structure download