Summary
IMPPAT Phytochemical identifier: IMPHY017935
Phytochemical name: 2-Pentyl propionate
Synonymous chemical names:2-pentyl propionate
Chemical structure information
SMILES:CCCC(OC(=O)CC)CInChI:InChI=1S/C8H16O2/c1-4-6-7(3)10-8(9)5-2/h7H,4-6H2,1-3H3InChIKey:IPVKBEOJURLVER-UHFFFAOYSA-N
DeepSMILES:CCCCOC=O)CC))))C
Functional groups:COC(C)=O
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Organic acids and derivativesClassyFire Class: Carboxylic acids and derivatives
ClassyFire Subclass: Carboxylic acid derivatives
NP Classifier Biosynthetic pathway: Fatty acids
NP Classifier Superclass: Fatty esters
NP Classifier Class: Wax monoesters
NP-Likeness score: 0.558
Chemical structure download