Summary
IMPPAT Phytochemical identifier: IMPHY017952
Phytochemical name: 5, 7-Dimethoxy-1-naphthol
Synonymous chemical names:5, 7-dimethoxy-1-naphthol
Chemical structure information
SMILES:COc1cc(OC)cc2c1cccc2OInChI:InChI=1S/C12H12O3/c1-14-8-6-10-9(12(7-8)15-2)4-3-5-11(10)13/h3-7,13H,1-2H3InChIKey:IBUVQIDQHISWIU-UHFFFAOYSA-N
DeepSMILES:COcccOC))ccc6cccc6O
Functional groups:cO, cOC
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccc2ccccc2c1
Scaffold Graph/Node level:C1CCC2CCCCC2C1
Scaffold Graph level:C1CCC2CCCCC2C1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: BenzenoidsClassyFire Class: Naphthalenes
ClassyFire Subclass: Naphthols and derivatives
NP Classifier Biosynthetic pathway: Polyketides
NP Classifier Superclass: Naphthalenes
NP Classifier Class: Naphthalenes and derivatives
NP-Likeness score: 0.463
Chemical structure download