Summary
IMPPAT Phytochemical identifier: IMPPAT3_PHYID014697
Phytochemical name: Propterol-b
Synonymous chemical names:propterol b, Propterol B, propterol-b
Chemical structure information
SMILES:Oc1ccc(cc1)CC(Cc1ccc(cc1O)O)OInChI:InChI=1S/C15H16O4/c16-12-4-1-10(2-5-12)7-14(18)8-11-3-6-13(17)9-15(11)19/h1-6,9,14,16-19H,7-8H2InChIKey:HBFNWMJHTGIQRB-UHFFFAOYSA-N
DeepSMILES:Occcccc6))CCCcccccc6O)))O))))))O
Functional groups:cO, CO
Molecular scaffolds
Scaffold Graph/Node/Bond level:c1ccc(CCCc2ccccc2)cc1
Scaffold Graph/Node level:C1CCC(CCCC2CCCCC2)CC1
Scaffold Graph level:C1CCC(CCCC2CCCCC2)CC1
Chemical classification
ClassyFire Kingdom: Organic compounds
ClassyFire Superclass: Phenylpropanoids and polyketidesClassyFire Class: Linear 1,3-diarylpropanoids
ClassyFire Subclass: Cinnamylphenols
NP Classifier Biosynthetic pathway: Shikimates and Phenylpropanoids
NP Classifier Superclass: Flavonoids
NP Classifier Class: Chalcones
NP-Likeness score: 1.03
Chemical structure download