
| DEDuCT identifier | DED000895 |
|---|---|
| PubChem identifier | 31736 |
| CAS identifier | 2528-16-7 |
| DSSTox identifier | DTXSID9043938 |
| IUPAC name | 2-phenylmethoxycarbonylbenzoic acid |
| Category based on type of supporting evidence | Category IV |
| Broad category based on environmental source | Industry |
| Sub-category based on environmental source | Industrial Additive, Plasticizer, Solvent |
| Chemical kingdom | Organic compounds |
| Chemical super-class | Benzenoids |
| Chemical class | Benzene and substituted derivatives |
| SMILES | O=C(c1ccccc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C15H12O4/c16-14(17)12-8-4-5-9-13(12)15(18)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17) |
| InChIKey | XIKIUQUXDNHBFR-UHFFFAOYSA-N |
We have built a comprehensive resource which compiles potential endocrine disrupting chemicals (EDCs) based on the observed adverse effects or endocrine-mediated endpoints in published experiments on humans or rodents to support basic research. We are not responsible for any errors or omissions in the published research articles or supporting literature on potential EDCs compiled in this resource. Users are advised to exercise their own judgement on the weight of evidence for potential EDCs compiled in this resource. Importantly, our sole goal to build this resource on potential EDCs is to enable future basic research towards better understanding of the systems-level perturbations upon chemical exposure rather than influencing regulatory advice on chemical use.