Secondary metabolite: Deacetylcytochalasin C
Summary
Molecular formula: C28H35NO5
SMILES: CC1=C(C)[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]32[C@H]([C@@H]1O)/C=C/C[C@H](C)C(=O)[C@](/C=C/[C@H]3O)(C)OInChI: InChI=1S/C28H35NO5/c1-16-9-8-12-20-24(31)18(3)17(2)23-21(15-19-10-6-5-7-11-19)29-26(33)28(20,23)22(30)13-14-27(4,34)25(16)32/h5-8,10-14,16,20-24,30-31,34H,9,15H2,1-4H3,(H,29,33)/b12-8+,14-13+/t16-,20-,21-,22+,23-,24+,27+,28+/m0/s1InChIKey: AOIKFORBJLUJGZ-NIOUNHJPSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Alkaloids and derivativesClass: Cytochalasans
Synonymous chemical names:deacetylcytochalasin c
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 465.59 |
Log P | RDKit | 2.49 |
Topological polar surface area (Å2) | RDKit | 106.86 |
Number of hydrogen bond acceptors | RDKit | 5 |
Number of hydrogen bond donors | RDKit | 4 |
Number of carbon atoms | RDKit | 28 |
Number of heavy atoms | RDKit | 34 |
Number of heteroatoms | RDKit | 6 |
Number of nitrogen atoms | RDKit | 1 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 8 |
Stereochemical complexity | RDKit | 0.29 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 14 |
Number of sp3 hybridized carbon atoms | RDKit | 14 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.5 |
Shape complexity | RDKit | 0.5 |
Number of rotatable bonds | SwissADME | 2 |
Number of aliphatic carbocycles | RDKit | 2 |
Number of aliphatic heterocycles | RDKit | 1 |
Number of aliphatic rings | RDKit | 3 |
Number of aromatic carbocycles | RDKit | 1 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 1 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 0 |
Number of saturated heterocycles | RDKit | 1 |
Number of saturated rings | RDKit | 1 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |