Secondary metabolite: Ganoderic acid beta
Summary
Molecular formula: C30H44O6
SMILES: C[C@@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)CC/C=C(/C(=O)O)CInChI: InChI=1S/C30H44O6/c1-16(9-8-10-17(2)26(35)36)18-13-23(34)30(7)25-19(31)14-21-27(3,4)22(33)11-12-28(21,5)24(25)20(32)15-29(18,30)6/h10,16,18-19,21-22,31,33H,8-9,11-15H2,1-7H3,(H,35,36)/b17-10+/t16-,18-,19+,21+,22+,28+,29-,30+/m1/s1InChIKey: NJZMSAAKSXZIEC-UQOIKQOMSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Lipids and lipid-like moleculesClass: Prenol lipids
Sub class: Triterpenoids
Synonymous chemical names:ganoderic acid beta, ganoderic acid β
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 500.68 |
Log P | RDKit | 4.87 |
Topological polar surface area (Å2) | RDKit | 111.9 |
Number of hydrogen bond acceptors | RDKit | 5 |
Number of hydrogen bond donors | RDKit | 3 |
Number of carbon atoms | RDKit | 30 |
Number of heavy atoms | RDKit | 36 |
Number of heteroatoms | RDKit | 6 |
Number of nitrogen atoms | RDKit | 0 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 8 |
Stereochemical complexity | RDKit | 0.27 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 7 |
Number of sp3 hybridized carbon atoms | RDKit | 23 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.77 |
Shape complexity | RDKit | 0.77 |
Number of rotatable bonds | SwissADME | 5 |
Number of aliphatic carbocycles | RDKit | 4 |
Number of aliphatic heterocycles | RDKit | 0 |
Number of aliphatic rings | RDKit | 4 |
Number of aromatic carbocycles | RDKit | 0 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 0 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 2 |
Number of saturated heterocycles | RDKit | 0 |
Number of saturated rings | RDKit | 2 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |