Secondary metabolite: Ganoderic acid-MK
Summary
Molecular formula: C34H50O7
SMILES: CC(=O)OC(C(C1CC(C2(C1(C)CC=C1C2=CCC2C1(C)CCC(C2(C)C)OC(=O)C)C)O)C)C/C=C(/C(=O)O)CInChI: InChI=1S/C34H50O7/c1-19(30(38)39)10-12-26(40-21(3)35)20(2)25-18-28(37)34(9)24-11-13-27-31(5,6)29(41-22(4)36)15-16-32(27,7)23(24)14-17-33(25,34)8/h10-11,14,20,25-29,37H,12-13,15-18H2,1-9H3,(H,38,39)/b19-10+InChIKey: BCZACVDBVIYNMZ-VXLYETTFSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Lipids and lipid-like moleculesClass: Prenol lipids
Sub class: Triterpenoids
Synonymous chemical names:ganoderic acid mk, ganoderic acid-mk
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 570.77 |
Log P | RDKit | 6.4 |
Topological polar surface area (Å2) | RDKit | 110.13 |
Number of hydrogen bond acceptors | RDKit | 6 |
Number of hydrogen bond donors | RDKit | 2 |
Number of carbon atoms | RDKit | 34 |
Number of heavy atoms | RDKit | 41 |
Number of heteroatoms | RDKit | 7 |
Number of nitrogen atoms | RDKit | 0 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 9 |
Stereochemical complexity | RDKit | 0.26 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 9 |
Number of sp3 hybridized carbon atoms | RDKit | 25 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.74 |
Shape complexity | RDKit | 0.74 |
Number of rotatable bonds | SwissADME | 9 |
Number of aliphatic carbocycles | RDKit | 4 |
Number of aliphatic heterocycles | RDKit | 0 |
Number of aliphatic rings | RDKit | 4 |
Number of aromatic carbocycles | RDKit | 0 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 0 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 2 |
Number of saturated heterocycles | RDKit | 0 |
Number of saturated rings | RDKit | 2 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |