Secondary metabolite: Lanosta-7, 9(11), 23e-triene-3β, 22r, 25-triol
Summary
Molecular formula: C30H48O3
SMILES: O[C@@H]([C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C=CC(O)(C)CInChI: InChI=1S/C30H48O3/c1-19(23(31)13-15-26(2,3)33)20-11-17-30(8)22-9-10-24-27(4,5)25(32)14-16-28(24,6)21(22)12-18-29(20,30)7/h9,12-13,15,19-20,23-25,31-33H,10-11,14,16-18H2,1-8H3/t19-,20+,23+,24-,25-,28+,29+,30-/m0/s1InChIKey: ODDPCFPKYKNPDA-OLEJALSGSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Lipids and lipid-like moleculesClass: Prenol lipids
Sub class: Triterpenoids
Synonymous chemical names:lanosta-7, 9(11), 23e-triene-3β, 22r, 25-triol
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 456.71 |
Log P | RDKit | 6.2 |
Topological polar surface area (Å2) | RDKit | 60.69 |
Number of hydrogen bond acceptors | RDKit | 3 |
Number of hydrogen bond donors | RDKit | 3 |
Number of carbon atoms | RDKit | 30 |
Number of heavy atoms | RDKit | 33 |
Number of heteroatoms | RDKit | 3 |
Number of nitrogen atoms | RDKit | 0 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 8 |
Stereochemical complexity | RDKit | 0.27 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 6 |
Number of sp3 hybridized carbon atoms | RDKit | 24 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.8 |
Shape complexity | RDKit | 0.8 |
Number of rotatable bonds | SwissADME | 4 |
Number of aliphatic carbocycles | RDKit | 4 |
Number of aliphatic heterocycles | RDKit | 0 |
Number of aliphatic rings | RDKit | 4 |
Number of aromatic carbocycles | RDKit | 0 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 0 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 2 |
Number of saturated heterocycles | RDKit | 0 |
Number of saturated rings | RDKit | 2 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |