Secondary metabolite: 3a -Carboxyacetoxy-24-methylene-23-oxolanost-8-en-26-oic acid (carboxyacetylquercinic acidderivative 01)
Summary
Molecular formula: C34H50O7
SMILES: OC(=O)CC(=O)O[C@@H]1CC[C@]2([C@H](C1(C)C)CCC1=C2CC[C@]2([C@@]1(C)CC[C@@H]2[C@@H](CC(=O)C(=C)C(C(=O)O)C)C)C)CInChI: InChI=1S/C34H50O7/c1-19(17-25(35)20(2)21(3)30(39)40)22-11-15-34(8)24-9-10-26-31(4,5)27(41-29(38)18-28(36)37)13-14-32(26,6)23(24)12-16-33(22,34)7/h19,21-22,26-27H,2,9-18H2,1,3-8H3,(H,36,37)(H,39,40)/t19-,21?,22-,26+,27-,32-,33-,34+/m1/s1InChIKey: LJDYIANNVNRBHB-DAACNWGDSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Lipids and lipid-like moleculesClass: Prenol lipids
Sub class: Triterpenoids
Synonymous chemical names:3a -carboxyacetoxy-24-methylene-23-oxolanost-8-en-26-oic acid (carboxyacetylquercinic acidderivative 01), 3α-carboxyacetoxy-24-methylene-23-oxolanost-8-en-26-oic acid
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 570.77 |
Log P | RDKit | 6.99 |
Topological polar surface area (Å2) | RDKit | 117.97 |
Number of hydrogen bond acceptors | RDKit | 5 |
Number of hydrogen bond donors | RDKit | 2 |
Number of carbon atoms | RDKit | 34 |
Number of heavy atoms | RDKit | 41 |
Number of heteroatoms | RDKit | 7 |
Number of nitrogen atoms | RDKit | 0 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 8 |
Stereochemical complexity | RDKit | 0.24 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 8 |
Number of sp3 hybridized carbon atoms | RDKit | 26 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.76 |
Shape complexity | RDKit | 0.76 |
Number of rotatable bonds | SwissADME | 10 |
Number of aliphatic carbocycles | RDKit | 4 |
Number of aliphatic heterocycles | RDKit | 0 |
Number of aliphatic rings | RDKit | 4 |
Number of aromatic carbocycles | RDKit | 0 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 0 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 2 |
Number of saturated heterocycles | RDKit | 0 |
Number of saturated rings | RDKit | 2 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |