Secondary metabolite: 12b-Acetoxy-3b-hydroxy-7,11,15,23-tetraoxo-lanost-8,20e-diene-26-oic acid
Summary
Molecular formula: C32H42O9
SMILES: CC(=O)O[C@@H]1C(=O)C2=C([C@]3([C@@]1(C)[C@H](CC3=O)/C(=C/C(=O)CC(C(=O)O)C)/C)C)C(=O)C[C@@H]1[C@]2(C)CC[C@@H](C1(C)C)OInChI: InChI=1S/C32H42O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h11,16,19,21-22,27,36H,9-10,12-14H2,1-8H3,(H,39,40)/b15-11+/t16?,19-,21+,22+,27-,30+,31+,32+/m1/s1InChIKey: NPQPGDYTXMOILM-BOAPTOANSA-N
Chemical classification
Kingdom: Organic compounds
Super class: Lipids and lipid-like moleculesClass: Prenol lipids
Sub class: Triterpenoids
Synonymous chemical names:12b-acetoxy-3b-hydroxy-7,11,15,23-tetraoxo-lanost-8,20e-diene-26-oic acid, 12β-Acetoxy-3β-hydroxy- 7,11,15,23-tetraoxolanost- 8,20 E-diene-26-oic acid
Chemical structure download

Physicochemical properties
Property name | Tool | Property value |
---|
Molecular weight (g/mol) | RDKit | 570.68 |
Log P | RDKit | 3.8 |
Topological polar surface area (Å2) | RDKit | 152.11 |
Number of hydrogen bond acceptors | RDKit | 8 |
Number of hydrogen bond donors | RDKit | 2 |
Number of carbon atoms | RDKit | 32 |
Number of heavy atoms | RDKit | 41 |
Number of heteroatoms | RDKit | 9 |
Number of nitrogen atoms | RDKit | 0 |
Number of sulfur atoms | RDKit | 0 |
Number of chiral carbon atoms | RDKit | 8 |
Stereochemical complexity | RDKit | 0.25 |
Number of sp hybridized carbon atoms | RDKit | 0 |
Number of sp2 hybridized carbon atoms | RDKit | 10 |
Number of sp3 hybridized carbon atoms | RDKit | 22 |
Fraction of sp3 hybridized carbon atoms (Fsp3) | RDKit | 0.69 |
Shape complexity | RDKit | 0.69 |
Number of rotatable bonds | SwissADME | 7 |
Number of aliphatic carbocycles | RDKit | 4 |
Number of aliphatic heterocycles | RDKit | 0 |
Number of aliphatic rings | RDKit | 4 |
Number of aromatic carbocycles | RDKit | 0 |
Number of aromatic heterocycles | RDKit | 0 |
Number of aromatic rings | RDKit | 0 |
Total number of rings | RDKit | 4 |
Number of saturated carbocycles | RDKit | 2 |
Number of saturated heterocycles | RDKit | 0 |
Number of saturated rings | RDKit | 2 |
Number of Smallest Set of Smallest Rings (SSSR) | RDKit | 4 |